CHM 1046
General Chemistry II
Dr. Michael Blaber


Additional Aspects of Aqueous Equilibria

The Common-Ion Effect


A weak acid or weak base will partially ionize in aqueous solution. For example,

Ionic compounds (i.e. salts) dissociate completely in aqueous solution

What happens if a salt is added to a solution of a weak acid, and that salt contains a conjugate base to the weak acid?

Example: Acetic acid (HC2H3O2)

The ionization of acetic acid, a weak acid, is as follows:

HC2H3O2(aq) ó C2H3O2-(aq) + H+(aq)

Now let's add some Sodium Acetate salt.

NaC2H3O2(aq) à Na+(aq) + C2H3O2-(aq)

HC2H3O2(aq) ß C2H3O2-(aq) + H+(aq)

This shift to the left will also result in a decrease in the H+ concentration

The "Common Ion Effect":

The dissociation of a weak electrolyte is decreased by adding to the solution a strong electrolyte (i.e. a salt) that has an ion in common with the weak electrolyte

A similar type of result would be observed for the ionization of a weak base and the addition of a salt that represents the conjugate acid

NH3(aq) + H2O(l) ó NH4+(aq) + OH-(aq)


Acetic acid (CH3COOH) is a weak acid with the following ionization reaction:

CH3COOH + H2O Û H3O+ + CH3COO- Ka = 1.8 x 10-5

What is the pH of a solution that is 0.5M in acetic acid and 2.5M in sodium acetate, CH3COONa?

1.8 x 10-5 = [CH3COO-][H3O+]/[CH3COOH]

If XM = amount of acetic acid that dissociates, then X M of H3O+ and CH3COO- ions are formed. The added sodium acetate is a salt containing the cation of a strong base (Na+) and an anion of a weak acid (CH3COO-). This will dissociate completely in water to produce 2.5M each Na+ ion and CH3COO-. Thus, at equilibrium, the concentration of CH3COO- will be the sum of the amount produced by dissociation of the acetic acid, plus the amount from the dissociation of the sodium salt, i.e. [CH3COO-] = (X + 2.5)M

1.8 x 10-5 = (X + 2.5)(X)/(0.5 - X)

X2 + 2.50X - 0.9 x 10-5 = 0

This is a quadratic, and

X = 3.60 x 10-6M = [H3O+] = [H+]

pH = -log[H+] = -log(3.60 x 10-6) = 5.44

Can we use the shortcut to the quadratic?

0.5M acetic acid / 1.8 x 10-5 = 27,777 (which is greater than 100)

Therefore, the amount of acid that dissociates is small compared to the starting concentration. Thus, (0.5M - X) » (0.5M). If this is the case, then (X + 2.5) would also » (2.5M).

1.8 x 10-5 = (X + 2.5)(X)/(0.5 - X) » (2.5)(X)/(0.5)

9.0 x 10-6 = 2.5X

X = 3.60 x 10-6

This is the same answer as above when using the quadratic.


What is the pH of an aqueous solution that contains 0.15M NH3 and 0.05M (NH4)2SO4? The Kb for NH3 is 1.8 x 10-5.

(NH4)2SO4(aq) à 2NH4+(aq) + SO42-(aq)

NH3(aq) + H2O(l) ó NH4+(aq) + OH-(aq)

and at equilibrium:

Set X = amount of NH3 that will ionize as the reaction goes to equilibrium

We can now set up the equilibrium expression:

Kb = 1.8 x 10-5 = (X + 0.1)(X) / (0.15 - X)

1.8 x 10-5 (0.15 - X) = X2 + 0.1X

2.70 x 10-6 - 1.8 x 10-5 X = X2 + 0.1X

0 = X2 + 0.1X + 1.8 x 10-5 X - 2.70 x 10-6

0 = X2 + 0.100X - 2.70 x 10-6

This is a quadratic; a = 1, b = 0.1, c = -2.70 x 10-6. The solution(s) for X are:

Therefore, at equilibrium:

How does this pH compare to that expected if no (NH4)2SO4 salt were added?

NH3(aq) + H2O(l) ó NH4+(aq) + OH-(aq)

and at equilibrium:

The initial concentration of NH3 is 0.15M

Kb = 1.8 x 10-5 = X2 / (0.15 - X)

1.8 x 10-5 (0.15 - X) = X2

2.70 x 10-6 - 1.8 x 10-5 X = X2

X2 + 1.8 x 10-5 X - 2.70 x 10-6 = 0

This is a quadratic. The solutions are:

Therefore at equilibrium:

 


© 2000 Dr. Michael Blaber